C10H18F2O3S — CID 114983839
1-(4,4-difluorocyclohexyl)-3-methylsulfonylpropan-1-ol (PubChem CID 114983839) has the molecular formula C10H18F2O3S and a molecular weight of 256.31 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)-3-methylsulfonylpropan-1-ol.
| Compound Name | 1-(4,4-difluorocyclohexyl)-3-methylsulfonylpropan-1-ol |
|---|---|
| PubChem CID | 114983839 |
| Molecular Formula | C10H18F2O3S |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)-3-methylsulfonylpropan-1-ol |
| SMILES | CS(=O)(=O)CCC(O)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C10H18F2O3S/c1-16(14,15)7-4-9(13)8-2-5-10(11,12)6-3-8/h8-9,13H,2-7H2,1H3 |
| InChIKey | MTSXECSFPJJWRT-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |