C4H10N2O3 — CID 11499222
2,3-dihydroxypropylurea (PubChem CID 11499222) has the molecular formula C4H10N2O3 and a molecular weight of 134.14 g/mol. Its IUPAC name is 2,3-dihydroxypropylurea.
| Compound Name | 2,3-dihydroxypropylurea |
|---|---|
| PubChem CID | 11499222 |
| Molecular Formula | C4H10N2O3 |
| Molecular Weight | 134.14 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | 2,3-dihydroxypropylurea |
| SMILES | NC(=O)NCC(O)CO |
| InChI | InChI=1S/C4H10N2O3/c5-4(9)6-1-3(8)2-7/h3,7-8H,1-2H2,(H3,5,6,9) |
| InChIKey | IWJFGRNIFIABLP-UHFFFAOYSA-N |
| XLogP | -1.99 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.14 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |