C15H16O3 — CID 114999931
1,3-benzodioxol-5-yl(cyclohepten-1-yl)methanone (PubChem CID 114999931) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl(cyclohepten-1-yl)methanone.
| Compound Name | 1,3-benzodioxol-5-yl(cyclohepten-1-yl)methanone |
|---|---|
| PubChem CID | 114999931 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 1,3-benzodioxol-5-yl(cyclohepten-1-yl)methanone |
| SMILES | O=C(C1=CCCCCC1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H16O3/c16-15(11-5-3-1-2-4-6-11)12-7-8-13-14(9-12)18-10-17-13/h5,7-9H,1-4,6,10H2 |
| InChIKey | QPWPSLGYTJLJEV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |