5-hydroxy-1,4-dimethylpyrrolo[3,2-b]indole-2-carboxylic acid

C13H12N2O3 — CID 115007397

IUPAC5-hydroxy-1,4-dimethylpyrrolo[3,2-b]indole-2-carboxylic acid
SMILESCn1c(C(=O)O)cc2c1c1cccc(O)c1n2C
InChIInChI=1S/C13H12N2O3/c1-14-8-6-9(13(17)18)15(2)11(8)7-4-3-5-10(16)12(7)14/h3-6,16H,1-2H3,(H,17,18)
InChIKeyRFYYTZLGOVOUQB-UHFFFAOYSA-N
MW244.25 g/mol
LogP2.07
Rot. Bonds1

About 5-hydroxy-1,4-dimethylpyrrolo[3,2-b]indole-2-carboxylic acid

5-hydroxy-1,4-dimethylpyrrolo[3,2-b]indole-2-carboxylic acid (PubChem CID 115007397) has the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. Its IUPAC name is 5-hydroxy-1,4-dimethylpyrrolo[3,2-b]indole-2-carboxylic acid.

Molecular Properties

Compound Name5-hydroxy-1,4-dimethylpyrrolo[3,2-b]indole-2-carboxylic acid
PubChem CID115007397
Molecular FormulaC13H12N2O3
Molecular Weight244.25 g/mol
Exact Mass244.08
IUPAC Name5-hydroxy-1,4-dimethylpyrrolo[3,2-b]indole-2-carboxylic acid
SMILESCn1c(C(=O)O)cc2c1c1cccc(O)c1n2C
InChIInChI=1S/C13H12N2O3/c1-14-8-6-9(13(17)18)15(2)11(8)7-4-3-5-10(16)12(7)14/h3-6,16H,1-2H3,(H,17,18)
InChIKeyRFYYTZLGOVOUQB-UHFFFAOYSA-N
XLogP2.07
TPSA67.39 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.25
LogP ≤ 52.07
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 5-hydroxy-1,4-dimethylpyrrolo[3,2-b]indole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-hydroxy-1,4-dimethylpyrrolo[3,2-b]indole-2-carboxylic acid?
The IUPAC name of 5-hydroxy-1,4-dimethylpyrrolo[3,2-b]indole-2-carboxylic acid (CID 115007397) is 5-hydroxy-1,4-dimethylpyrrolo[3,2-b]indole-2-carboxylic acid.
What is the SMILES notation for 5-hydroxy-1,4-dimethylpyrrolo[3,2-b]indole-2-carboxylic acid?
The canonical SMILES for 5-hydroxy-1,4-dimethylpyrrolo[3,2-b]indole-2-carboxylic acid is Cn1c(C(=O)O)cc2c1c1cccc(O)c1n2C.
What is the InChIKey of 5-hydroxy-1,4-dimethylpyrrolo[3,2-b]indole-2-carboxylic acid?
The InChIKey is RFYYTZLGOVOUQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O3/c1-14-8-6-9(13(17)18)15(2)11(8)7-4-3-5-10(16)12(7)14/h3-6,16H,1-2H3,(H,17,18).
What are the key properties of 5-hydroxy-1,4-dimethylpyrrolo[3,2-b]indole-2-carboxylic acid?
5-hydroxy-1,4-dimethylpyrrolo[3,2-b]indole-2-carboxylic acid has a molecular weight of 244.25 g/mol, XLogP of 2.07, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-1,4-dimethylpyrrolo[3,2-b]indole-2-carboxylic acid is sourced from PubChem (CID 115007397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).