C13H12N2O3 — CID 115007397
5-hydroxy-1,4-dimethylpyrrolo[3,2-b]indole-2-carboxylic acid (PubChem CID 115007397) has the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. Its IUPAC name is 5-hydroxy-1,4-dimethylpyrrolo[3,2-b]indole-2-carboxylic acid.
| Compound Name | 5-hydroxy-1,4-dimethylpyrrolo[3,2-b]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 115007397 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 5-hydroxy-1,4-dimethylpyrrolo[3,2-b]indole-2-carboxylic acid |
| SMILES | Cn1c(C(=O)O)cc2c1c1cccc(O)c1n2C |
| InChI | InChI=1S/C13H12N2O3/c1-14-8-6-9(13(17)18)15(2)11(8)7-4-3-5-10(16)12(7)14/h3-6,16H,1-2H3,(H,17,18) |
| InChIKey | RFYYTZLGOVOUQB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 67.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |