7-hydroxy-1-methyl-[1]benzofuro[3,2-b]pyrrole-2-carboxylic acid

C12H9NO4 — CID 115007558

IUPAC7-hydroxy-1-methyl-[1]benzofuro[3,2-b]pyrrole-2-carboxylic acid
SMILESCn1c(C(=O)O)cc2oc3ccc(O)cc3c21
InChIInChI=1S/C12H9NO4/c1-13-8(12(15)16)5-10-11(13)7-4-6(14)2-3-9(7)17-10/h2-5,14H,1H3,(H,15,16)
InChIKeyCSNMMTGQRRFPNA-UHFFFAOYSA-N
MW231.21 g/mol
LogP2.33
Rot. Bonds1

About 7-hydroxy-1-methyl-[1]benzofuro[3,2-b]pyrrole-2-carboxylic acid

7-hydroxy-1-methyl-[1]benzofuro[3,2-b]pyrrole-2-carboxylic acid (PubChem CID 115007558) has the molecular formula C12H9NO4 and a molecular weight of 231.21 g/mol. Its IUPAC name is 7-hydroxy-1-methyl-[1]benzofuro[3,2-b]pyrrole-2-carboxylic acid.

Molecular Properties

Compound Name7-hydroxy-1-methyl-[1]benzofuro[3,2-b]pyrrole-2-carboxylic acid
PubChem CID115007558
Molecular FormulaC12H9NO4
Molecular Weight231.21 g/mol
Exact Mass231.05
IUPAC Name7-hydroxy-1-methyl-[1]benzofuro[3,2-b]pyrrole-2-carboxylic acid
SMILESCn1c(C(=O)O)cc2oc3ccc(O)cc3c21
InChIInChI=1S/C12H9NO4/c1-13-8(12(15)16)5-10-11(13)7-4-6(14)2-3-9(7)17-10/h2-5,14H,1H3,(H,15,16)
InChIKeyCSNMMTGQRRFPNA-UHFFFAOYSA-N
XLogP2.33
TPSA75.60 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.21
LogP ≤ 52.33
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 7-hydroxy-1-methyl-[1]benzofuro[3,2-b]pyrrole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-hydroxy-1-methyl-[1]benzofuro[3,2-b]pyrrole-2-carboxylic acid?
The IUPAC name of 7-hydroxy-1-methyl-[1]benzofuro[3,2-b]pyrrole-2-carboxylic acid (CID 115007558) is 7-hydroxy-1-methyl-[1]benzofuro[3,2-b]pyrrole-2-carboxylic acid.
What is the SMILES notation for 7-hydroxy-1-methyl-[1]benzofuro[3,2-b]pyrrole-2-carboxylic acid?
The canonical SMILES for 7-hydroxy-1-methyl-[1]benzofuro[3,2-b]pyrrole-2-carboxylic acid is Cn1c(C(=O)O)cc2oc3ccc(O)cc3c21.
What is the InChIKey of 7-hydroxy-1-methyl-[1]benzofuro[3,2-b]pyrrole-2-carboxylic acid?
The InChIKey is CSNMMTGQRRFPNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO4/c1-13-8(12(15)16)5-10-11(13)7-4-6(14)2-3-9(7)17-10/h2-5,14H,1H3,(H,15,16).
What are the key properties of 7-hydroxy-1-methyl-[1]benzofuro[3,2-b]pyrrole-2-carboxylic acid?
7-hydroxy-1-methyl-[1]benzofuro[3,2-b]pyrrole-2-carboxylic acid has a molecular weight of 231.21 g/mol, XLogP of 2.33, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxy-1-methyl-[1]benzofuro[3,2-b]pyrrole-2-carboxylic acid is sourced from PubChem (CID 115007558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).