C19H32O3Si — CID 11500964
(3aS,4S,9aS,9bR)-6-methyl-4-triethylsilyloxy-3a,4,5,7,8,9,9a,9b-octahydro-3H-azuleno[4,5-b]furan-2-one (PubChem CID 11500964) has the molecular formula C19H32O3Si and a molecular weight of 336.55 g/mol. Its IUPAC name is (3aS,4S,9aS,9bR)-6-methyl-4-triethylsilyloxy-3a,4,5,7,8,9,9a,9b-octahydro-3H-azuleno[4,5-b]furan-2-one.
| Compound Name | (3aS,4S,9aS,9bR)-6-methyl-4-triethylsilyloxy-3a,4,5,7,8,9,9a,9b-octahydro-3H-azuleno[4,5-b]furan-2-one |
|---|---|
| PubChem CID | 11500964 |
| Molecular Formula | C19H32O3Si |
| Molecular Weight | 336.55 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | (3aS,4S,9aS,9bR)-6-methyl-4-triethylsilyloxy-3a,4,5,7,8,9,9a,9b-octahydro-3H-azuleno[4,5-b]furan-2-one |
| SMILES | CC[Si](CC)(CC)O[C@H]1CC(C)=C2CCC[C@@H]2[C@H]2OC(=O)C[C@@H]21 |
| InChI | InChI=1S/C19H32O3Si/c1-5-23(6-2,7-3)22-17-11-13(4)14-9-8-10-15(14)19-16(17)12-18(20)21-19/h15-17,19H,5-12H2,1-4H3/t15-,16+,17-,19+/m0/s1 |
| InChIKey | ZYQVSZRLVKVHNR-MJQMVNBJSA-N |
| XLogP | 4.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.55 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|