C12H15NO2 — CID 115010472
2,6-dimethyl-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-4-amine (PubChem CID 115010472) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 2,6-dimethyl-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-4-amine.
| Compound Name | 2,6-dimethyl-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-4-amine |
|---|---|
| PubChem CID | 115010472 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 2,6-dimethyl-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-4-amine |
| SMILES | CC1Cc2c(cc3c(c2N)OC(C)C3)O1 |
| InChI | InChI=1S/C12H15NO2/c1-6-3-8-5-10-9(4-7(2)14-10)11(13)12(8)15-6/h5-7H,3-4,13H2,1-2H3 |
| InChIKey | NRXJILURIIPYEU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|