About 2-fluoropropanimidamide
2-fluoropropanimidamide (PubChem CID 115011027) has the molecular formula C3H7FN2
and a molecular weight of 90.10 g/mol. Its IUPAC name is 2-fluoropropanimidamide.
Molecular Properties
| Compound Name | 2-fluoropropanimidamide |
| PubChem CID | 115011027 |
| Molecular Formula | C3H7FN2 |
| Molecular Weight | 90.10 g/mol |
| Exact Mass | 90.06 |
| IUPAC Name | 2-fluoropropanimidamide |
| SMILES | [H]/N=C(\N)C(C)F |
| InChI | InChI=1S/C3H7FN2/c1-2(4)3(5)6/h2H,1H3,(H3,5,6) |
| InChIKey | IEYONQPMIVOIIH-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 90.10 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoropropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoropropanimidamide?
The IUPAC name of 2-fluoropropanimidamide (CID 115011027) is 2-fluoropropanimidamide.
What is the SMILES notation for 2-fluoropropanimidamide?
The canonical SMILES for 2-fluoropropanimidamide is [H]/N=C(\N)C(C)F.
What is the InChIKey of 2-fluoropropanimidamide?
The InChIKey is IEYONQPMIVOIIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7FN2/c1-2(4)3(5)6/h2H,1H3,(H3,5,6).
What are the key properties of 2-fluoropropanimidamide?
2-fluoropropanimidamide has a molecular weight of 90.10 g/mol, XLogP of 0.28, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoropropanimidamide is sourced from PubChem (CID 115011027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).