About 4-fluorobutanimidamide
4-fluorobutanimidamide (PubChem CID 81106725) has the molecular formula C4H9FN2
and a molecular weight of 104.13 g/mol. Its IUPAC name is 4-fluorobutanimidamide.
Molecular Properties
| Compound Name | 4-fluorobutanimidamide |
| PubChem CID | 81106725 |
| Molecular Formula | C4H9FN2 |
| Molecular Weight | 104.13 g/mol |
| Exact Mass | 104.07 |
| IUPAC Name | 4-fluorobutanimidamide |
| SMILES | [H]/N=C(/N)CCCF |
| InChI | InChI=1S/C4H9FN2/c5-3-1-2-4(6)7/h1-3H2,(H3,6,7) |
| InChIKey | HKUJPHKESMKHAP-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.13 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-fluorobutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluorobutanimidamide?
The IUPAC name of 4-fluorobutanimidamide (CID 81106725) is 4-fluorobutanimidamide.
What is the SMILES notation for 4-fluorobutanimidamide?
The canonical SMILES for 4-fluorobutanimidamide is [H]/N=C(/N)CCCF.
What is the InChIKey of 4-fluorobutanimidamide?
The InChIKey is HKUJPHKESMKHAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9FN2/c5-3-1-2-4(6)7/h1-3H2,(H3,6,7).
What are the key properties of 4-fluorobutanimidamide?
4-fluorobutanimidamide has a molecular weight of 104.13 g/mol, XLogP of 0.67, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluorobutanimidamide is sourced from PubChem (CID 81106725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).