About 2-fluoroethanimidamide
2-fluoroethanimidamide (PubChem CID 3562756) has the molecular formula C2H5FN2
and a molecular weight of 76.07 g/mol. Its IUPAC name is 2-fluoroethanimidamide.
Molecular Properties
| Compound Name | 2-fluoroethanimidamide |
| PubChem CID | 3562756 |
| Molecular Formula | C2H5FN2 |
| Molecular Weight | 76.07 g/mol |
| Exact Mass | 76.04 |
| IUPAC Name | 2-fluoroethanimidamide |
| SMILES | [H]/N=C(/N)CF |
| InChI | InChI=1S/C2H5FN2/c3-1-2(4)5/h1H2,(H3,4,5) |
| InChIKey | HAIYEFMGUXOXIY-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 76.07 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoroethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoroethanimidamide?
The IUPAC name of 2-fluoroethanimidamide (CID 3562756) is 2-fluoroethanimidamide.
What is the SMILES notation for 2-fluoroethanimidamide?
The canonical SMILES for 2-fluoroethanimidamide is [H]/N=C(/N)CF.
What is the InChIKey of 2-fluoroethanimidamide?
The InChIKey is HAIYEFMGUXOXIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5FN2/c3-1-2(4)5/h1H2,(H3,4,5).
What are the key properties of 2-fluoroethanimidamide?
2-fluoroethanimidamide has a molecular weight of 76.07 g/mol, XLogP of -0.11, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoroethanimidamide is sourced from PubChem (CID 3562756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).