C3H6F2N2 — CID 60921770
3,3-difluoropropanimidamide (PubChem CID 60921770) has the molecular formula C3H6F2N2 and a molecular weight of 108.09 g/mol. Its IUPAC name is 3,3-difluoropropanimidamide.
| Compound Name | 3,3-difluoropropanimidamide |
|---|---|
| PubChem CID | 60921770 |
| Molecular Formula | C3H6F2N2 |
| Molecular Weight | 108.09 g/mol |
| Exact Mass | 108.05 |
| IUPAC Name | 3,3-difluoropropanimidamide |
| SMILES | [H]/N=C(\N)CC(F)F |
| InChI | InChI=1S/C3H6F2N2/c4-2(5)1-3(6)7/h2H,1H2,(H3,6,7) |
| InChIKey | PQXOVQOVAHNJHX-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 108.09 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|