C8H9N3O2 — CID 115015321
6-amino-5-ethyl-1H-[1,3]oxazolo[5,4-b]pyridin-2-one (PubChem CID 115015321) has the molecular formula C8H9N3O2 and a molecular weight of 179.18 g/mol. Its IUPAC name is 6-amino-5-ethyl-1H-[1,3]oxazolo[5,4-b]pyridin-2-one.
| Compound Name | 6-amino-5-ethyl-1H-[1,3]oxazolo[5,4-b]pyridin-2-one |
|---|---|
| PubChem CID | 115015321 |
| Molecular Formula | C8H9N3O2 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 6-amino-5-ethyl-1H-[1,3]oxazolo[5,4-b]pyridin-2-one |
| SMILES | CCc1nc2oc(=O)[nH]c2cc1N |
| InChI | InChI=1S/C8H9N3O2/c1-2-5-4(9)3-6-7(10-5)13-8(12)11-6/h3H,2,9H2,1H3,(H,11,12) |
| InChIKey | WKGJEVIXBGKKEQ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |