C11H14N4O2 — CID 115040087
6-amino-5-piperidin-4-yl-1H-[1,3]oxazolo[5,4-b]pyridin-2-one (PubChem CID 115040087) has the molecular formula C11H14N4O2 and a molecular weight of 234.26 g/mol. Its IUPAC name is 6-amino-5-piperidin-4-yl-1H-[1,3]oxazolo[5,4-b]pyridin-2-one.
| Compound Name | 6-amino-5-piperidin-4-yl-1H-[1,3]oxazolo[5,4-b]pyridin-2-one |
|---|---|
| PubChem CID | 115040087 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 6-amino-5-piperidin-4-yl-1H-[1,3]oxazolo[5,4-b]pyridin-2-one |
| SMILES | Nc1cc2[nH]c(=O)oc2nc1C1CCNCC1 |
| InChI | InChI=1S/C11H14N4O2/c12-7-5-8-10(17-11(16)14-8)15-9(7)6-1-3-13-4-2-6/h5-6,13H,1-4,12H2,(H,14,16) |
| InChIKey | BNXFRQBAXGMPRH-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |