C11H15NO2 — CID 115019414
3-(aminomethyl)-4-methyl-3,4-dihydro-2H-chromen-8-ol (PubChem CID 115019414) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 3-(aminomethyl)-4-methyl-3,4-dihydro-2H-chromen-8-ol.
| Compound Name | 3-(aminomethyl)-4-methyl-3,4-dihydro-2H-chromen-8-ol |
|---|---|
| PubChem CID | 115019414 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 3-(aminomethyl)-4-methyl-3,4-dihydro-2H-chromen-8-ol |
| SMILES | CC1c2cccc(O)c2OCC1CN |
| InChI | InChI=1S/C11H15NO2/c1-7-8(5-12)6-14-11-9(7)3-2-4-10(11)13/h2-4,7-8,13H,5-6,12H2,1H3 |
| InChIKey | RZERHGOTLYMKKD-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |