About stilbene
stilbene (PubChem CID 11502) has the molecular formula C14H12
and a molecular weight of 180.25 g/mol. Its IUPAC name is stilbene.
Molecular Properties
| Compound Name | stilbene |
| PubChem CID | 11502 |
| Molecular Formula | C14H12 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | stilbene |
| SMILES | C(=Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H12/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14/h1-12H |
| InChIKey | PJANXHGTPQOBST-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze stilbene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of stilbene?
The IUPAC name of stilbene (CID 11502) is stilbene.
What is the SMILES notation for stilbene?
The canonical SMILES for stilbene is C(=Cc1ccccc1)c1ccccc1.
What is the InChIKey of stilbene?
The InChIKey is PJANXHGTPQOBST-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14/h1-12H.
What are the key properties of stilbene?
stilbene has a molecular weight of 180.25 g/mol, XLogP of 3.86, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for stilbene is sourced from PubChem (CID 11502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).