C11H20OS — CID 115022115
(7,7-dimethyl-3-thiabicyclo[3.3.1]nonan-9-yl)methanol (PubChem CID 115022115) has the molecular formula C11H20OS and a molecular weight of 200.35 g/mol. Its IUPAC name is (7,7-dimethyl-3-thiabicyclo[3.3.1]nonan-9-yl)methanol.
| Compound Name | (7,7-dimethyl-3-thiabicyclo[3.3.1]nonan-9-yl)methanol |
|---|---|
| PubChem CID | 115022115 |
| Molecular Formula | C11H20OS |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | (7,7-dimethyl-3-thiabicyclo[3.3.1]nonan-9-yl)methanol |
| SMILES | CC1(C)CC2CSCC(C1)C2CO |
| InChI | InChI=1S/C11H20OS/c1-11(2)3-8-6-13-7-9(4-11)10(8)5-12/h8-10,12H,3-7H2,1-2H3 |
| InChIKey | BVAYHJOZIUWHBC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |