C10H11NO4 — CID 115026250
6-propylpyridine-3,4-dicarboxylic acid (PubChem CID 115026250) has the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. Its IUPAC name is 6-propylpyridine-3,4-dicarboxylic acid.
| Compound Name | 6-propylpyridine-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 115026250 |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 6-propylpyridine-3,4-dicarboxylic acid |
| SMILES | CCCc1cc(C(=O)O)c(C(=O)O)cn1 |
| InChI | InChI=1S/C10H11NO4/c1-2-3-6-4-7(9(12)13)8(5-11-6)10(14)15/h4-5H,2-3H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | PVEHWHRXKXGAMH-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |