C10H6F3NO — CID 115028174
7-isocyanato-2-(trifluoromethyl)bicyclo[4.2.0]octa-1(6),2,4-triene (PubChem CID 115028174) has the molecular formula C10H6F3NO and a molecular weight of 213.16 g/mol. Its IUPAC name is 7-isocyanato-2-(trifluoromethyl)bicyclo[4.2.0]octa-1(6),2,4-triene.
| Compound Name | 7-isocyanato-2-(trifluoromethyl)bicyclo[4.2.0]octa-1(6),2,4-triene |
|---|---|
| PubChem CID | 115028174 |
| Molecular Formula | C10H6F3NO |
| Molecular Weight | 213.16 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | 7-isocyanato-2-(trifluoromethyl)bicyclo[4.2.0]octa-1(6),2,4-triene |
| SMILES | O=C=NC1Cc2c1cccc2C(F)(F)F |
| InChI | InChI=1S/C10H6F3NO/c11-10(12,13)8-3-1-2-6-7(8)4-9(6)14-5-15/h1-3,9H,4H2 |
| InChIKey | DBJGTCBTCKIMSO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.16 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|