C9H11NO3S — CID 115028323
2-(3-methylthiolan-3-yl)-1,3-oxazole-4-carboxylic acid (PubChem CID 115028323) has the molecular formula C9H11NO3S and a molecular weight of 213.26 g/mol. Its IUPAC name is 2-(3-methylthiolan-3-yl)-1,3-oxazole-4-carboxylic acid.
| Compound Name | 2-(3-methylthiolan-3-yl)-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 115028323 |
| Molecular Formula | C9H11NO3S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.05 |
| IUPAC Name | 2-(3-methylthiolan-3-yl)-1,3-oxazole-4-carboxylic acid |
| SMILES | CC1(c2nc(C(=O)O)co2)CCSC1 |
| InChI | InChI=1S/C9H11NO3S/c1-9(2-3-14-5-9)8-10-6(4-13-8)7(11)12/h4H,2-3,5H2,1H3,(H,11,12) |
| InChIKey | NSINSNQRKVFUKH-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |