2-[2-(3-methylthiolan-3-yl)-1,3-oxazol-4-yl]acetic acid

C10H13NO3S — CID 115036185

IUPAC2-[2-(3-methylthiolan-3-yl)-1,3-oxazol-4-yl]acetic acid
SMILESCC1(c2nc(CC(=O)O)co2)CCSC1
InChIInChI=1S/C10H13NO3S/c1-10(2-3-15-6-10)9-11-7(5-14-9)4-8(12)13/h5H,2-4,6H2,1H3,(H,12,13)
InChIKeyMILJEKRCLRSTCH-UHFFFAOYSA-N
MW227.28 g/mol
LogP1.70
Rot. Bonds3

About 2-[2-(3-methylthiolan-3-yl)-1,3-oxazol-4-yl]acetic acid

2-[2-(3-methylthiolan-3-yl)-1,3-oxazol-4-yl]acetic acid (PubChem CID 115036185) has the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. Its IUPAC name is 2-[2-(3-methylthiolan-3-yl)-1,3-oxazol-4-yl]acetic acid.

Molecular Properties

Compound Name2-[2-(3-methylthiolan-3-yl)-1,3-oxazol-4-yl]acetic acid
PubChem CID115036185
Molecular FormulaC10H13NO3S
Molecular Weight227.28 g/mol
Exact Mass227.06
IUPAC Name2-[2-(3-methylthiolan-3-yl)-1,3-oxazol-4-yl]acetic acid
SMILESCC1(c2nc(CC(=O)O)co2)CCSC1
InChIInChI=1S/C10H13NO3S/c1-10(2-3-15-6-10)9-11-7(5-14-9)4-8(12)13/h5H,2-4,6H2,1H3,(H,12,13)
InChIKeyMILJEKRCLRSTCH-UHFFFAOYSA-N
XLogP1.70
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.28
LogP ≤ 51.70
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[2-(3-methylthiolan-3-yl)-1,3-oxazol-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(3-methylthiolan-3-yl)-1,3-oxazol-4-yl]acetic acid?
The IUPAC name of 2-[2-(3-methylthiolan-3-yl)-1,3-oxazol-4-yl]acetic acid (CID 115036185) is 2-[2-(3-methylthiolan-3-yl)-1,3-oxazol-4-yl]acetic acid.
What is the SMILES notation for 2-[2-(3-methylthiolan-3-yl)-1,3-oxazol-4-yl]acetic acid?
The canonical SMILES for 2-[2-(3-methylthiolan-3-yl)-1,3-oxazol-4-yl]acetic acid is CC1(c2nc(CC(=O)O)co2)CCSC1.
What is the InChIKey of 2-[2-(3-methylthiolan-3-yl)-1,3-oxazol-4-yl]acetic acid?
The InChIKey is MILJEKRCLRSTCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3S/c1-10(2-3-15-6-10)9-11-7(5-14-9)4-8(12)13/h5H,2-4,6H2,1H3,(H,12,13).
What are the key properties of 2-[2-(3-methylthiolan-3-yl)-1,3-oxazol-4-yl]acetic acid?
2-[2-(3-methylthiolan-3-yl)-1,3-oxazol-4-yl]acetic acid has a molecular weight of 227.28 g/mol, XLogP of 1.70, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3-methylthiolan-3-yl)-1,3-oxazol-4-yl]acetic acid is sourced from PubChem (CID 115036185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).