C8H13FO4S — CID 115034362
4-(2-fluoropropyl)-1,1-dioxothiolane-3-carboxylic acid (PubChem CID 115034362) has the molecular formula C8H13FO4S and a molecular weight of 224.25 g/mol. Its IUPAC name is 4-(2-fluoropropyl)-1,1-dioxothiolane-3-carboxylic acid.
| Compound Name | 4-(2-fluoropropyl)-1,1-dioxothiolane-3-carboxylic acid |
|---|---|
| PubChem CID | 115034362 |
| Molecular Formula | C8H13FO4S |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 4-(2-fluoropropyl)-1,1-dioxothiolane-3-carboxylic acid |
| SMILES | CC(F)CC1CS(=O)(=O)CC1C(=O)O |
| InChI | InChI=1S/C8H13FO4S/c1-5(9)2-6-3-14(12,13)4-7(6)8(10)11/h5-7H,2-4H2,1H3,(H,10,11) |
| InChIKey | ZFAXWUUQYXVLSF-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |