C10H18N4S — CID 115035822
3-[3-(thian-3-yl)-1H-1,2,4-triazol-5-yl]propan-1-amine (PubChem CID 115035822) has the molecular formula C10H18N4S and a molecular weight of 226.35 g/mol. Its IUPAC name is 3-[3-(thian-3-yl)-1H-1,2,4-triazol-5-yl]propan-1-amine.
| Compound Name | 3-[3-(thian-3-yl)-1H-1,2,4-triazol-5-yl]propan-1-amine |
|---|---|
| PubChem CID | 115035822 |
| Molecular Formula | C10H18N4S |
| Molecular Weight | 226.35 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 3-[3-(thian-3-yl)-1H-1,2,4-triazol-5-yl]propan-1-amine |
| SMILES | NCCCc1nc(C2CCCSC2)n[nH]1 |
| InChI | InChI=1S/C10H18N4S/c11-5-1-4-9-12-10(14-13-9)8-3-2-6-15-7-8/h8H,1-7,11H2,(H,12,13,14) |
| InChIKey | HGPQTLBLRSPQGT-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |