About 3-[3-(thian-3-yl)-1H-1,2,4-triazol-5-yl]propan-1-amine
3-[3-(thian-3-yl)-1H-1,2,4-triazol-5-yl]propan-1-amine (PubChem CID 115035822) has the molecular formula C10H18N4S
and a molecular weight of 226.35 g/mol. Its IUPAC name is 3-[3-(thian-3-yl)-1H-1,2,4-triazol-5-yl]propan-1-amine.
Molecular Properties
| Compound Name | 3-[3-(thian-3-yl)-1H-1,2,4-triazol-5-yl]propan-1-amine |
| PubChem CID | 115035822 |
| Molecular Formula | C10H18N4S |
| Molecular Weight | 226.35 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 3-[3-(thian-3-yl)-1H-1,2,4-triazol-5-yl]propan-1-amine |
| SMILES | NCCCc1nc(C2CCCSC2)n[nH]1 |
| InChI | InChI=1S/C10H18N4S/c11-5-1-4-9-12-10(14-13-9)8-3-2-6-15-7-8/h8H,1-7,11H2,(H,12,13,14) |
| InChIKey | HGPQTLBLRSPQGT-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[3-(thian-3-yl)-1H-1,2,4-triazol-5-yl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(thian-3-yl)-1H-1,2,4-triazol-5-yl]propan-1-amine?
The IUPAC name of 3-[3-(thian-3-yl)-1H-1,2,4-triazol-5-yl]propan-1-amine (CID 115035822) is 3-[3-(thian-3-yl)-1H-1,2,4-triazol-5-yl]propan-1-amine.
What is the SMILES notation for 3-[3-(thian-3-yl)-1H-1,2,4-triazol-5-yl]propan-1-amine?
The canonical SMILES for 3-[3-(thian-3-yl)-1H-1,2,4-triazol-5-yl]propan-1-amine is NCCCc1nc(C2CCCSC2)n[nH]1.
What is the InChIKey of 3-[3-(thian-3-yl)-1H-1,2,4-triazol-5-yl]propan-1-amine?
The InChIKey is HGPQTLBLRSPQGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4S/c11-5-1-4-9-12-10(14-13-9)8-3-2-6-15-7-8/h8H,1-7,11H2,(H,12,13,14).
What are the key properties of 3-[3-(thian-3-yl)-1H-1,2,4-triazol-5-yl]propan-1-amine?
3-[3-(thian-3-yl)-1H-1,2,4-triazol-5-yl]propan-1-amine has a molecular weight of 226.35 g/mol, XLogP of 1.31, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(thian-3-yl)-1H-1,2,4-triazol-5-yl]propan-1-amine is sourced from PubChem (CID 115035822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).