C14H19N3 — CID 115037404
3,5-dimethyl-2-piperidin-4-ylimidazo[1,2-a]pyridine (PubChem CID 115037404) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is 3,5-dimethyl-2-piperidin-4-ylimidazo[1,2-a]pyridine.
| Compound Name | 3,5-dimethyl-2-piperidin-4-ylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 115037404 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 3,5-dimethyl-2-piperidin-4-ylimidazo[1,2-a]pyridine |
| SMILES | Cc1cccc2nc(C3CCNCC3)c(C)n12 |
| InChI | InChI=1S/C14H19N3/c1-10-4-3-5-13-16-14(11(2)17(10)13)12-6-8-15-9-7-12/h3-5,12,15H,6-9H2,1-2H3 |
| InChIKey | RWUBXHQLFMMLMW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |