C13H14N2 — CID 115403962
4-methyl-3,9-diazatetracyclo[9.2.1.02,10.03,8]tetradeca-2(10),4,6,8-tetraene (PubChem CID 115403962) has the molecular formula C13H14N2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 4-methyl-3,9-diazatetracyclo[9.2.1.02,10.03,8]tetradeca-2(10),4,6,8-tetraene.
| Compound Name | 4-methyl-3,9-diazatetracyclo[9.2.1.02,10.03,8]tetradeca-2(10),4,6,8-tetraene |
|---|---|
| PubChem CID | 115403962 |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 4-methyl-3,9-diazatetracyclo[9.2.1.02,10.03,8]tetradeca-2(10),4,6,8-tetraene |
| SMILES | Cc1cccc2nc3c(n12)C1CCC3C1 |
| InChI | InChI=1S/C13H14N2/c1-8-3-2-4-11-14-12-9-5-6-10(7-9)13(12)15(8)11/h2-4,9-10H,5-7H2,1H3 |
| InChIKey | IUHHCXPNHFHCGJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |