C9H15FO4S — CID 115042525
3-(1,1-dioxothiolan-3-yl)-4-fluoropentanoic acid (PubChem CID 115042525) has the molecular formula C9H15FO4S and a molecular weight of 238.28 g/mol. Its IUPAC name is 3-(1,1-dioxothiolan-3-yl)-4-fluoropentanoic acid.
| Compound Name | 3-(1,1-dioxothiolan-3-yl)-4-fluoropentanoic acid |
|---|---|
| PubChem CID | 115042525 |
| Molecular Formula | C9H15FO4S |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 3-(1,1-dioxothiolan-3-yl)-4-fluoropentanoic acid |
| SMILES | CC(F)C(CC(=O)O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H15FO4S/c1-6(10)8(4-9(11)12)7-2-3-15(13,14)5-7/h6-8H,2-5H2,1H3,(H,11,12) |
| InChIKey | UKCIWOHVPRZBMY-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |