C7H13ClO5S2 — CID 115051117
2-(1,1-dioxothian-4-yl)-2-hydroxyethanesulfonyl chloride (PubChem CID 115051117) has the molecular formula C7H13ClO5S2 and a molecular weight of 276.76 g/mol. Its IUPAC name is 2-(1,1-dioxothian-4-yl)-2-hydroxyethanesulfonyl chloride.
| Compound Name | 2-(1,1-dioxothian-4-yl)-2-hydroxyethanesulfonyl chloride |
|---|---|
| PubChem CID | 115051117 |
| Molecular Formula | C7H13ClO5S2 |
| Molecular Weight | 276.76 g/mol |
| Exact Mass | 275.99 |
| IUPAC Name | 2-(1,1-dioxothian-4-yl)-2-hydroxyethanesulfonyl chloride |
| SMILES | O=S(=O)(Cl)CC(O)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C7H13ClO5S2/c8-15(12,13)5-7(9)6-1-3-14(10,11)4-2-6/h6-7,9H,1-5H2 |
| InChIKey | YSNCNRHYDUGXJP-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.76 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |