C11H21NO3S — CID 117238543
2-(cyclobutylamino)-1-(1,1-dioxothian-4-yl)ethanol (PubChem CID 117238543) has the molecular formula C11H21NO3S and a molecular weight of 247.36 g/mol. Its IUPAC name is 2-(cyclobutylamino)-1-(1,1-dioxothian-4-yl)ethanol.
| Compound Name | 2-(cyclobutylamino)-1-(1,1-dioxothian-4-yl)ethanol |
|---|---|
| PubChem CID | 117238543 |
| Molecular Formula | C11H21NO3S |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 2-(cyclobutylamino)-1-(1,1-dioxothian-4-yl)ethanol |
| SMILES | O=S1(=O)CCC(C(O)CNC2CCC2)CC1 |
| InChI | InChI=1S/C11H21NO3S/c13-11(8-12-10-2-1-3-10)9-4-6-16(14,15)7-5-9/h9-13H,1-8H2 |
| InChIKey | CAJNHNDCFGTXMG-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |