C8H16N2O4S — CID 64583635
2-amino-3-[(1,1-dioxothian-4-yl)amino]propanoic acid (PubChem CID 64583635) has the molecular formula C8H16N2O4S and a molecular weight of 236.29 g/mol. Its IUPAC name is 2-amino-3-[(1,1-dioxothian-4-yl)amino]propanoic acid.
| Compound Name | 2-amino-3-[(1,1-dioxothian-4-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 64583635 |
| Molecular Formula | C8H16N2O4S |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 2-amino-3-[(1,1-dioxothian-4-yl)amino]propanoic acid |
| SMILES | NC(CNC1CCS(=O)(=O)CC1)C(=O)O |
| InChI | InChI=1S/C8H16N2O4S/c9-7(8(11)12)5-10-6-1-3-15(13,14)4-2-6/h6-7,10H,1-5,9H2,(H,11,12) |
| InChIKey | WCQZZPBFPHPWQA-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |