2-amino-3-[(1,1-dioxothian-4-yl)amino]propanoic acid

C8H16N2O4S — CID 64583635

IUPAC2-amino-3-[(1,1-dioxothian-4-yl)amino]propanoic acid
SMILESNC(CNC1CCS(=O)(=O)CC1)C(=O)O
InChIInChI=1S/C8H16N2O4S/c9-7(8(11)12)5-10-6-1-3-15(13,14)4-2-6/h6-7,10H,1-5,9H2,(H,11,12)
InChIKeyWCQZZPBFPHPWQA-UHFFFAOYSA-N
MW236.29 g/mol
LogP-1.43
Rot. Bonds4

About 2-amino-3-[(1,1-dioxothian-4-yl)amino]propanoic acid

2-amino-3-[(1,1-dioxothian-4-yl)amino]propanoic acid (PubChem CID 64583635) has the molecular formula C8H16N2O4S and a molecular weight of 236.29 g/mol. Its IUPAC name is 2-amino-3-[(1,1-dioxothian-4-yl)amino]propanoic acid.

Molecular Properties

Compound Name2-amino-3-[(1,1-dioxothian-4-yl)amino]propanoic acid
PubChem CID64583635
Molecular FormulaC8H16N2O4S
Molecular Weight236.29 g/mol
Exact Mass236.08
IUPAC Name2-amino-3-[(1,1-dioxothian-4-yl)amino]propanoic acid
SMILESNC(CNC1CCS(=O)(=O)CC1)C(=O)O
InChIInChI=1S/C8H16N2O4S/c9-7(8(11)12)5-10-6-1-3-15(13,14)4-2-6/h6-7,10H,1-5,9H2,(H,11,12)
InChIKeyWCQZZPBFPHPWQA-UHFFFAOYSA-N
XLogP-1.43
TPSA109.49 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.29
LogP ≤ 5-1.43
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 2-amino-3-[(1,1-dioxothian-4-yl)amino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-3-[(1,1-dioxothian-4-yl)amino]propanoic acid?
The IUPAC name of 2-amino-3-[(1,1-dioxothian-4-yl)amino]propanoic acid (CID 64583635) is 2-amino-3-[(1,1-dioxothian-4-yl)amino]propanoic acid.
What is the SMILES notation for 2-amino-3-[(1,1-dioxothian-4-yl)amino]propanoic acid?
The canonical SMILES for 2-amino-3-[(1,1-dioxothian-4-yl)amino]propanoic acid is NC(CNC1CCS(=O)(=O)CC1)C(=O)O.
What is the InChIKey of 2-amino-3-[(1,1-dioxothian-4-yl)amino]propanoic acid?
The InChIKey is WCQZZPBFPHPWQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O4S/c9-7(8(11)12)5-10-6-1-3-15(13,14)4-2-6/h6-7,10H,1-5,9H2,(H,11,12).
What are the key properties of 2-amino-3-[(1,1-dioxothian-4-yl)amino]propanoic acid?
2-amino-3-[(1,1-dioxothian-4-yl)amino]propanoic acid has a molecular weight of 236.29 g/mol, XLogP of -1.43, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-[(1,1-dioxothian-4-yl)amino]propanoic acid is sourced from PubChem (CID 64583635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).