C12H21NO4S — CID 117239504
3-(cyclobutylamino)-2-(1,1-dioxothian-4-yl)propanoic acid (PubChem CID 117239504) has the molecular formula C12H21NO4S and a molecular weight of 275.37 g/mol. Its IUPAC name is 3-(cyclobutylamino)-2-(1,1-dioxothian-4-yl)propanoic acid.
| Compound Name | 3-(cyclobutylamino)-2-(1,1-dioxothian-4-yl)propanoic acid |
|---|---|
| PubChem CID | 117239504 |
| Molecular Formula | C12H21NO4S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 3-(cyclobutylamino)-2-(1,1-dioxothian-4-yl)propanoic acid |
| SMILES | O=C(O)C(CNC1CCC1)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H21NO4S/c14-12(15)11(8-13-10-2-1-3-10)9-4-6-18(16,17)7-5-9/h9-11,13H,1-8H2,(H,14,15) |
| InChIKey | HFIMSTBMQARIBH-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |