About (8-methoxy-1-methyl-3,4-dihydronaphthalen-2-yl)methanamine
(8-methoxy-1-methyl-3,4-dihydronaphthalen-2-yl)methanamine (PubChem CID 115057448) has the molecular formula C13H17NO
and a molecular weight of 203.28 g/mol. Its IUPAC name is (8-methoxy-1-methyl-3,4-dihydronaphthalen-2-yl)methanamine.
Molecular Properties
| Compound Name | (8-methoxy-1-methyl-3,4-dihydronaphthalen-2-yl)methanamine |
| PubChem CID | 115057448 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | (8-methoxy-1-methyl-3,4-dihydronaphthalen-2-yl)methanamine |
| SMILES | COc1cccc2c1C(C)=C(CN)CC2 |
| InChI | InChI=1S/C13H17NO/c1-9-11(8-14)7-6-10-4-3-5-12(15-2)13(9)10/h3-5H,6-8,14H2,1-2H3 |
| InChIKey | KBCKZIFNCWAHMQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (8-methoxy-1-methyl-3,4-dihydronaphthalen-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-methoxy-1-methyl-3,4-dihydronaphthalen-2-yl)methanamine?
The IUPAC name of (8-methoxy-1-methyl-3,4-dihydronaphthalen-2-yl)methanamine (CID 115057448) is (8-methoxy-1-methyl-3,4-dihydronaphthalen-2-yl)methanamine.
What is the SMILES notation for (8-methoxy-1-methyl-3,4-dihydronaphthalen-2-yl)methanamine?
The canonical SMILES for (8-methoxy-1-methyl-3,4-dihydronaphthalen-2-yl)methanamine is COc1cccc2c1C(C)=C(CN)CC2.
What is the InChIKey of (8-methoxy-1-methyl-3,4-dihydronaphthalen-2-yl)methanamine?
The InChIKey is KBCKZIFNCWAHMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO/c1-9-11(8-14)7-6-10-4-3-5-12(15-2)13(9)10/h3-5H,6-8,14H2,1-2H3.
What are the key properties of (8-methoxy-1-methyl-3,4-dihydronaphthalen-2-yl)methanamine?
(8-methoxy-1-methyl-3,4-dihydronaphthalen-2-yl)methanamine has a molecular weight of 203.28 g/mol, XLogP of 2.37, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (8-methoxy-1-methyl-3,4-dihydronaphthalen-2-yl)methanamine is sourced from PubChem (CID 115057448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).