C14H19NO2S — CID 174157420
tert-butyl-[(7-methoxy-2,3-dihydroinden-1-ylidene)amino]-oxidosulfanium (PubChem CID 174157420) has the molecular formula C14H19NO2S and a molecular weight of 265.38 g/mol. Its IUPAC name is tert-butyl-[(7-methoxy-2,3-dihydroinden-1-ylidene)amino]-oxidosulfanium.
| Compound Name | tert-butyl-[(7-methoxy-2,3-dihydroinden-1-ylidene)amino]-oxidosulfanium |
|---|---|
| PubChem CID | 174157420 |
| Molecular Formula | C14H19NO2S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | tert-butyl-[(7-methoxy-2,3-dihydroinden-1-ylidene)amino]-oxidosulfanium |
| SMILES | COc1cccc2c1C(=N[S+]([O-])C(C)(C)C)CC2 |
| InChI | InChI=1S/C14H19NO2S/c1-14(2,3)18(16)15-11-9-8-10-6-5-7-12(17-4)13(10)11/h5-7H,8-9H2,1-4H3 |
| InChIKey | ZDRLPCOORFCUKQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 44.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|