About 2-(2-cyclobutyl-4,5-dihydro-1,3-oxazol-5-yl)ethanamine
2-(2-cyclobutyl-4,5-dihydro-1,3-oxazol-5-yl)ethanamine (PubChem CID 115060647) has the molecular formula C9H16N2O
and a molecular weight of 168.24 g/mol. Its IUPAC name is 2-(2-cyclobutyl-4,5-dihydro-1,3-oxazol-5-yl)ethanamine.
Analyze 2-(2-cyclobutyl-4,5-dihydro-1,3-oxazol-5-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-cyclobutyl-4,5-dihydro-1,3-oxazol-5-yl)ethanamine?
The IUPAC name of 2-(2-cyclobutyl-4,5-dihydro-1,3-oxazol-5-yl)ethanamine (CID 115060647) is 2-(2-cyclobutyl-4,5-dihydro-1,3-oxazol-5-yl)ethanamine.
What is the SMILES notation for 2-(2-cyclobutyl-4,5-dihydro-1,3-oxazol-5-yl)ethanamine?
The canonical SMILES for 2-(2-cyclobutyl-4,5-dihydro-1,3-oxazol-5-yl)ethanamine is NCCC1CN=C(C2CCC2)O1.
What is the InChIKey of 2-(2-cyclobutyl-4,5-dihydro-1,3-oxazol-5-yl)ethanamine?
The InChIKey is FCVGNFLIXMHMGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O/c10-5-4-8-6-11-9(12-8)7-2-1-3-7/h7-8H,1-6,10H2.
What are the key properties of 2-(2-cyclobutyl-4,5-dihydro-1,3-oxazol-5-yl)ethanamine?
2-(2-cyclobutyl-4,5-dihydro-1,3-oxazol-5-yl)ethanamine has a molecular weight of 168.24 g/mol, XLogP of 0.93, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-cyclobutyl-4,5-dihydro-1,3-oxazol-5-yl)ethanamine is sourced from PubChem (CID 115060647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).