About (5-cyclohexyl-4,5-dihydro-1,3-oxazol-2-yl)methanamine
(5-cyclohexyl-4,5-dihydro-1,3-oxazol-2-yl)methanamine (PubChem CID 115061533) has the molecular formula C10H18N2O
and a molecular weight of 182.27 g/mol. Its IUPAC name is (5-cyclohexyl-4,5-dihydro-1,3-oxazol-2-yl)methanamine.
Analyze (5-cyclohexyl-4,5-dihydro-1,3-oxazol-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-cyclohexyl-4,5-dihydro-1,3-oxazol-2-yl)methanamine?
The IUPAC name of (5-cyclohexyl-4,5-dihydro-1,3-oxazol-2-yl)methanamine (CID 115061533) is (5-cyclohexyl-4,5-dihydro-1,3-oxazol-2-yl)methanamine.
What is the SMILES notation for (5-cyclohexyl-4,5-dihydro-1,3-oxazol-2-yl)methanamine?
The canonical SMILES for (5-cyclohexyl-4,5-dihydro-1,3-oxazol-2-yl)methanamine is NCC1=NCC(C2CCCCC2)O1.
What is the InChIKey of (5-cyclohexyl-4,5-dihydro-1,3-oxazol-2-yl)methanamine?
The InChIKey is ALUAVTWQHUSCJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O/c11-6-10-12-7-9(13-10)8-4-2-1-3-5-8/h8-9H,1-7,11H2.
What are the key properties of (5-cyclohexyl-4,5-dihydro-1,3-oxazol-2-yl)methanamine?
(5-cyclohexyl-4,5-dihydro-1,3-oxazol-2-yl)methanamine has a molecular weight of 182.27 g/mol, XLogP of 1.32, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-cyclohexyl-4,5-dihydro-1,3-oxazol-2-yl)methanamine is sourced from PubChem (CID 115061533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).