About 9-cyclononyloxazonane
9-cyclononyloxazonane (PubChem CID 71145462) has the molecular formula C16H31NO
and a molecular weight of 253.43 g/mol. Its IUPAC name is 9-cyclononyloxazonane.
Molecular Properties
| Compound Name | 9-cyclononyloxazonane |
| PubChem CID | 71145462 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | 9-cyclononyloxazonane |
| SMILES | C1CCCCC(C2CCCCCCNO2)CCC1 |
| InChI | InChI=1S/C16H31NO/c1-2-4-8-12-15(11-7-3-1)16-13-9-5-6-10-14-17-18-16/h15-17H,1-14H2 |
| InChIKey | VKTDSWREYXYUPQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-cyclononyloxazonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-cyclononyloxazonane?
The IUPAC name of 9-cyclononyloxazonane (CID 71145462) is 9-cyclononyloxazonane.
What is the SMILES notation for 9-cyclononyloxazonane?
The canonical SMILES for 9-cyclononyloxazonane is C1CCCCC(C2CCCCCCNO2)CCC1.
What is the InChIKey of 9-cyclononyloxazonane?
The InChIKey is VKTDSWREYXYUPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31NO/c1-2-4-8-12-15(11-7-3-1)16-13-9-5-6-10-14-17-18-16/h15-17H,1-14H2.
What are the key properties of 9-cyclononyloxazonane?
9-cyclononyloxazonane has a molecular weight of 253.43 g/mol, XLogP of 4.59, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-cyclononyloxazonane is sourced from PubChem (CID 71145462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).