C15H26O4S — CID 134886146
(4S,6S)-4,6-dicyclohexyl-1,3,2-dioxathiane 2,2-dioxide (PubChem CID 134886146) has the molecular formula C15H26O4S and a molecular weight of 302.44 g/mol. Its IUPAC name is (4S,6S)-4,6-dicyclohexyl-1,3,2-dioxathiane 2,2-dioxide.
| Compound Name | (4S,6S)-4,6-dicyclohexyl-1,3,2-dioxathiane 2,2-dioxide |
|---|---|
| PubChem CID | 134886146 |
| Molecular Formula | C15H26O4S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | (4S,6S)-4,6-dicyclohexyl-1,3,2-dioxathiane 2,2-dioxide |
| SMILES | O=S1(=O)O[C@H](C2CCCCC2)C[C@@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C15H26O4S/c16-20(17)18-14(12-7-3-1-4-8-12)11-15(19-20)13-9-5-2-6-10-13/h12-15H,1-11H2/t14-,15-/m0/s1 |
| InChIKey | AGWYKYMEWBUBKU-GJZGRUSLSA-N |
| XLogP | 3.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |