C13H12F3NO4 — CID 115062318
4-methyl-5-oxo-2-[4-(trifluoromethyl)phenyl]morpholine-3-carboxylic acid (PubChem CID 115062318) has the molecular formula C13H12F3NO4 and a molecular weight of 303.24 g/mol. Its IUPAC name is 4-methyl-5-oxo-2-[4-(trifluoromethyl)phenyl]morpholine-3-carboxylic acid.
| Compound Name | 4-methyl-5-oxo-2-[4-(trifluoromethyl)phenyl]morpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 115062318 |
| Molecular Formula | C13H12F3NO4 |
| Molecular Weight | 303.24 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 4-methyl-5-oxo-2-[4-(trifluoromethyl)phenyl]morpholine-3-carboxylic acid |
| SMILES | CN1C(=O)COC(c2ccc(C(F)(F)F)cc2)C1C(=O)O |
| InChI | InChI=1S/C13H12F3NO4/c1-17-9(18)6-21-11(10(17)12(19)20)7-2-4-8(5-3-7)13(14,15)16/h2-5,10-11H,6H2,1H3,(H,19,20) |
| InChIKey | AHVZVELOLIZVDX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.24 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |