C76H112O2Si6 — CID 11506374
6,13-bis(2-trimethylsilylethynyl)-2,3,9,10-tetrakis[2-tri(propan-2-yl)silylethynyl]pentacene-6,13-diol (PubChem CID 11506374) has the molecular formula C76H112O2Si6 and a molecular weight of 1226.25 g/mol. Its IUPAC name is 6,13-bis(2-trimethylsilylethynyl)-2,3,9,10-tetrakis[2-tri(propan-2-yl)silylethynyl]pentacene-6,13-diol.
| Compound Name | 6,13-bis(2-trimethylsilylethynyl)-2,3,9,10-tetrakis[2-tri(propan-2-yl)silylethynyl]pentacene-6,13-diol |
|---|---|
| PubChem CID | 11506374 |
| Molecular Formula | C76H112O2Si6 |
| Molecular Weight | 1226.25 g/mol |
| Exact Mass | 1224.73 |
| IUPAC Name | 6,13-bis(2-trimethylsilylethynyl)-2,3,9,10-tetrakis[2-tri(propan-2-yl)silylethynyl]pentacene-6,13-diol |
| SMILES | CC(C)[Si](C#Cc1cc2cc3c(cc2cc1C#C[Si](C(C)C)(C(C)C)C(C)C)C(O)(C#C[Si](C)(C)C)c1cc2cc(C#C[Si](C(C)C)(C(C)C)C(C)C)c(C#C[Si](C(C)C)(C(C)C)C(C)C)cc2cc1C3(O)C#C[Si](C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C76H112O2Si6/c1-51(2)81(52(3)4,53(5)6)37-31-63-43-67-47-71-72(48-68(67)44-64(63)32-38-82(54(7)8,55(9)10)56(11)12)76(78,36-42-80(28,29)30)74-50-70-46-66(34-40-84(60(19)20,61(21)22)62(23)24)65(33-39-83(57(13)14,58(15)16)59(17)18)45-69(70)49-73(74)75(71,77)35-41-79(25,26)27/h43-62,77-78H,1-30H3 |
| InChIKey | XNWQUBADSBZCRU-UHFFFAOYSA-N |
| XLogP | 20.82 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1226.25 |
| LogP ≤ 5 | 20.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|