C13H16N2O3 — CID 115065078
3-(2-hydroxyphenyl)-5-pyrrolidin-3-yl-1,3-oxazolidin-2-one (PubChem CID 115065078) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 3-(2-hydroxyphenyl)-5-pyrrolidin-3-yl-1,3-oxazolidin-2-one.
| Compound Name | 3-(2-hydroxyphenyl)-5-pyrrolidin-3-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 115065078 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 3-(2-hydroxyphenyl)-5-pyrrolidin-3-yl-1,3-oxazolidin-2-one |
| SMILES | O=C1OC(C2CCNC2)CN1c1ccccc1O |
| InChI | InChI=1S/C13H16N2O3/c16-11-4-2-1-3-10(11)15-8-12(18-13(15)17)9-5-6-14-7-9/h1-4,9,12,14,16H,5-8H2 |
| InChIKey | FCKGJUYCTSLGQD-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |