C15H17F3N2O2 — CID 115064963
5-piperidin-3-yl-3-[3-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one (PubChem CID 115064963) has the molecular formula C15H17F3N2O2 and a molecular weight of 314.31 g/mol. Its IUPAC name is 5-piperidin-3-yl-3-[3-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one.
| Compound Name | 5-piperidin-3-yl-3-[3-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 115064963 |
| Molecular Formula | C15H17F3N2O2 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 5-piperidin-3-yl-3-[3-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OC(C2CCCNC2)CN1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H17F3N2O2/c16-15(17,18)11-4-1-5-12(7-11)20-9-13(22-14(20)21)10-3-2-6-19-8-10/h1,4-5,7,10,13,19H,2-3,6,8-9H2 |
| InChIKey | NTVOUMXLHONJTN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |