C15H13ClF3NO3 — CID 78206250
6-chloro-3-[3-(trifluoromethyl)phenyl]-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxazine-2,4-dione (PubChem CID 78206250) has the molecular formula C15H13ClF3NO3 and a molecular weight of 347.72 g/mol. Its IUPAC name is 6-chloro-3-[3-(trifluoromethyl)phenyl]-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxazine-2,4-dione.
| Compound Name | 6-chloro-3-[3-(trifluoromethyl)phenyl]-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxazine-2,4-dione |
|---|---|
| PubChem CID | 78206250 |
| Molecular Formula | C15H13ClF3NO3 |
| Molecular Weight | 347.72 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 6-chloro-3-[3-(trifluoromethyl)phenyl]-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxazine-2,4-dione |
| SMILES | O=C1OC2CCC(Cl)CC2C(=O)N1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H13ClF3NO3/c16-9-4-5-12-11(7-9)13(21)20(14(22)23-12)10-3-1-2-8(6-10)15(17,18)19/h1-3,6,9,11-12H,4-5,7H2 |
| InChIKey | YQKVJGRXTJDFKM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.72 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|