C12H11F3N4OS — CID 53442419
6-sulfanylidene-5-[3-(trifluoromethyl)phenyl]-1,2,3,3a,7,7a-hexahydropyrazolo[3,4-d]pyrimidin-4-one (PubChem CID 53442419) has the molecular formula C12H11F3N4OS and a molecular weight of 316.31 g/mol. Its IUPAC name is 6-sulfanylidene-5-[3-(trifluoromethyl)phenyl]-1,2,3,3a,7,7a-hexahydropyrazolo[3,4-d]pyrimidin-4-one.
| Compound Name | 6-sulfanylidene-5-[3-(trifluoromethyl)phenyl]-1,2,3,3a,7,7a-hexahydropyrazolo[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 53442419 |
| Molecular Formula | C12H11F3N4OS |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 6-sulfanylidene-5-[3-(trifluoromethyl)phenyl]-1,2,3,3a,7,7a-hexahydropyrazolo[3,4-d]pyrimidin-4-one |
| SMILES | O=C1C2CNNC2NC(=S)N1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H11F3N4OS/c13-12(14,15)6-2-1-3-7(4-6)19-10(20)8-5-16-18-9(8)17-11(19)21/h1-4,8-9,16,18H,5H2,(H,17,21) |
| InChIKey | NAVDJTKJHFMTNQ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|