C14H18N2O3 — CID 115064972
3-(3-hydroxyphenyl)-5-piperidin-3-yl-1,3-oxazolidin-2-one (PubChem CID 115064972) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 3-(3-hydroxyphenyl)-5-piperidin-3-yl-1,3-oxazolidin-2-one.
| Compound Name | 3-(3-hydroxyphenyl)-5-piperidin-3-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 115064972 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 3-(3-hydroxyphenyl)-5-piperidin-3-yl-1,3-oxazolidin-2-one |
| SMILES | O=C1OC(C2CCCNC2)CN1c1cccc(O)c1 |
| InChI | InChI=1S/C14H18N2O3/c17-12-5-1-4-11(7-12)16-9-13(19-14(16)18)10-3-2-6-15-8-10/h1,4-5,7,10,13,15,17H,2-3,6,8-9H2 |
| InChIKey | WLHDRHWGDPNYPT-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |