C11H18N2O2 — CID 115064955
3-cyclopropyl-5-piperidin-3-yl-1,3-oxazolidin-2-one (PubChem CID 115064955) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 3-cyclopropyl-5-piperidin-3-yl-1,3-oxazolidin-2-one.
| Compound Name | 3-cyclopropyl-5-piperidin-3-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 115064955 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 3-cyclopropyl-5-piperidin-3-yl-1,3-oxazolidin-2-one |
| SMILES | O=C1OC(C2CCCNC2)CN1C1CC1 |
| InChI | InChI=1S/C11H18N2O2/c14-11-13(9-3-4-9)7-10(15-11)8-2-1-5-12-6-8/h8-10,12H,1-7H2 |
| InChIKey | ORPWZGAQPVGRPG-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |