C15H20N2O3 — CID 115065022
3-[(3-hydroxyphenyl)methyl]-5-piperidin-3-yl-1,3-oxazolidin-2-one (PubChem CID 115065022) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 3-[(3-hydroxyphenyl)methyl]-5-piperidin-3-yl-1,3-oxazolidin-2-one.
| Compound Name | 3-[(3-hydroxyphenyl)methyl]-5-piperidin-3-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 115065022 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 3-[(3-hydroxyphenyl)methyl]-5-piperidin-3-yl-1,3-oxazolidin-2-one |
| SMILES | O=C1OC(C2CCCNC2)CN1Cc1cccc(O)c1 |
| InChI | InChI=1S/C15H20N2O3/c18-13-5-1-3-11(7-13)9-17-10-14(20-15(17)19)12-4-2-6-16-8-12/h1,3,5,7,12,14,16,18H,2,4,6,8-10H2 |
| InChIKey | KKIWKULDZPOOOU-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |