C9H12N4O3S — CID 11507135
methyl (2S,4S)-2-azido-4-cyano-4-methyl-5-methylsulfanyl-5-oxopentanoate (PubChem CID 11507135) has the molecular formula C9H12N4O3S and a molecular weight of 256.29 g/mol. Its IUPAC name is methyl (2S,4S)-2-azido-4-cyano-4-methyl-5-methylsulfanyl-5-oxopentanoate.
| Compound Name | methyl (2S,4S)-2-azido-4-cyano-4-methyl-5-methylsulfanyl-5-oxopentanoate |
|---|---|
| PubChem CID | 11507135 |
| Molecular Formula | C9H12N4O3S |
| Molecular Weight | 256.29 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | methyl (2S,4S)-2-azido-4-cyano-4-methyl-5-methylsulfanyl-5-oxopentanoate |
| SMILES | COC(=O)[C@H](C[C@@](C)(C#N)C(=O)SC)N=[N+]=[N-] |
| InChI | InChI=1S/C9H12N4O3S/c1-9(5-10,8(15)17-3)4-6(12-13-11)7(14)16-2/h6H,4H2,1-3H3/t6-,9-/m0/s1 |
| InChIKey | PQDHTQJTIJMNPE-RCOVLWMOSA-N |
| XLogP | 1.65 |
| TPSA | 115.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.29 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|