C6H9N3O5 — CID 57343420
(2S,3S)-3-azido-2-hydroxy-4-methoxy-2-methyl-4-oxobutanoic acid (PubChem CID 57343420) has the molecular formula C6H9N3O5 and a molecular weight of 203.15 g/mol. Its IUPAC name is (2S,3S)-3-azido-2-hydroxy-4-methoxy-2-methyl-4-oxobutanoic acid.
| Compound Name | (2S,3S)-3-azido-2-hydroxy-4-methoxy-2-methyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 57343420 |
| Molecular Formula | C6H9N3O5 |
| Molecular Weight | 203.15 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | (2S,3S)-3-azido-2-hydroxy-4-methoxy-2-methyl-4-oxobutanoic acid |
| SMILES | COC(=O)[C@@H](N=[N+]=[N-])[C@](C)(O)C(=O)O |
| InChI | InChI=1S/C6H9N3O5/c1-6(13,5(11)12)3(8-9-7)4(10)14-2/h3,13H,1-2H3,(H,11,12)/t3-,6+/m1/s1 |
| InChIKey | RJNRWJAJMGWHCT-CVYQJGLWSA-N |
| XLogP | -0.33 |
| TPSA | 132.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.15 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|