C19H29N5O9 — CID 57343422
dimethyl (2S)-2-[[(2S,3R)-2-[[(2S,3S)-3-azido-2-hydroxy-4-methoxy-2-methyl-4-oxobutanoyl]amino]-3,4-dimethylpent-4-enoyl]amino]butanedioate (PubChem CID 57343422) has the molecular formula C19H29N5O9 and a molecular weight of 471.47 g/mol. Its IUPAC name is dimethyl (2S)-2-[[(2S,3R)-2-[[(2S,3S)-3-azido-2-hydroxy-4-methoxy-2-methyl-4-oxobutanoyl]amino]-3,4-dimethylpent-4-enoyl]amino]butanedioate.
| Compound Name | dimethyl (2S)-2-[[(2S,3R)-2-[[(2S,3S)-3-azido-2-hydroxy-4-methoxy-2-methyl-4-oxobutanoyl]amino]-3,4-dimethylpent-4-enoyl]amino]butanedioate |
|---|---|
| PubChem CID | 57343422 |
| Molecular Formula | C19H29N5O9 |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | dimethyl (2S)-2-[[(2S,3R)-2-[[(2S,3S)-3-azido-2-hydroxy-4-methoxy-2-methyl-4-oxobutanoyl]amino]-3,4-dimethylpent-4-enoyl]amino]butanedioate |
| SMILES | C=C(C)[C@@H](C)[C@H](NC(=O)[C@@](C)(O)[C@H](N=[N+]=[N-])C(=O)OC)C(=O)N[C@@H](CC(=O)OC)C(=O)OC |
| InChI | InChI=1S/C19H29N5O9/c1-9(2)10(3)13(15(26)21-11(16(27)32-6)8-12(25)31-5)22-18(29)19(4,30)14(23-24-20)17(28)33-7/h10-11,13-14,30H,1,8H2,2-7H3,(H,21,26)(H,22,29)/t10-,11+,13+,14-,19+/m1/s1 |
| InChIKey | XLKPRQGBKMFMHR-AODBPKJPSA-N |
| XLogP | -0.49 |
| TPSA | 206.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|