C10H12ClN5O5 — CID 11507980
2-amino-8-[(2R,3S,4R,5R)-3-chloro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]imidazo[1,2-a][1,3,5]triazin-4-one (PubChem CID 11507980) has the molecular formula C10H12ClN5O5 and a molecular weight of 317.69 g/mol. Its IUPAC name is 2-amino-8-[(2R,3S,4R,5R)-3-chloro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]imidazo[1,2-a][1,3,5]triazin-4-one.
| Compound Name | 2-amino-8-[(2R,3S,4R,5R)-3-chloro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]imidazo[1,2-a][1,3,5]triazin-4-one |
|---|---|
| PubChem CID | 11507980 |
| Molecular Formula | C10H12ClN5O5 |
| Molecular Weight | 317.69 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 2-amino-8-[(2R,3S,4R,5R)-3-chloro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]imidazo[1,2-a][1,3,5]triazin-4-one |
| SMILES | Nc1nc(=O)n2ccn([C@@H]3O[C@H](CO)[C@@H](O)[C@]3(O)Cl)c2n1 |
| InChI | InChI=1S/C10H12ClN5O5/c11-10(20)5(18)4(3-17)21-6(10)15-1-2-16-8(15)13-7(12)14-9(16)19/h1-2,4-6,17-18,20H,3H2,(H2,12,14,19)/t4-,5-,6-,10-/m1/s1 |
| InChIKey | IYJYLBMSBLKVPV-PLDPKQSISA-N |
| XLogP | -2.35 |
| TPSA | 148.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.69 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|