C10H13N5O4S — CID 58603081
2-amino-8-[3,4-dihydroxy-5-(sulfanylmethyl)oxolan-2-yl]imidazo[1,2-a][1,3,5]triazin-4-one (PubChem CID 58603081) has the molecular formula C10H13N5O4S and a molecular weight of 299.31 g/mol. Its IUPAC name is 2-amino-8-[3,4-dihydroxy-5-(sulfanylmethyl)oxolan-2-yl]imidazo[1,2-a][1,3,5]triazin-4-one.
| Compound Name | 2-amino-8-[3,4-dihydroxy-5-(sulfanylmethyl)oxolan-2-yl]imidazo[1,2-a][1,3,5]triazin-4-one |
|---|---|
| PubChem CID | 58603081 |
| Molecular Formula | C10H13N5O4S |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 2-amino-8-[3,4-dihydroxy-5-(sulfanylmethyl)oxolan-2-yl]imidazo[1,2-a][1,3,5]triazin-4-one |
| SMILES | Nc1nc(=O)n2ccn(C3OC(CS)C(O)C3O)c2n1 |
| InChI | InChI=1S/C10H13N5O4S/c11-8-12-9-14(1-2-15(9)10(18)13-8)7-6(17)5(16)4(3-20)19-7/h1-2,4-7,16-17,20H,3H2,(H2,11,13,18) |
| InChIKey | NWYCCVSYPQJRBW-UHFFFAOYSA-N |
| XLogP | -1.98 |
| TPSA | 127.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|