C10H12N8O4 — CID 58603110
2-amino-8-[5-(azidomethyl)-3,4-dihydroxyoxolan-2-yl]imidazo[1,2-a][1,3,5]triazin-4-one (PubChem CID 58603110) has the molecular formula C10H12N8O4 and a molecular weight of 308.26 g/mol. Its IUPAC name is 2-amino-8-[5-(azidomethyl)-3,4-dihydroxyoxolan-2-yl]imidazo[1,2-a][1,3,5]triazin-4-one.
| Compound Name | 2-amino-8-[5-(azidomethyl)-3,4-dihydroxyoxolan-2-yl]imidazo[1,2-a][1,3,5]triazin-4-one |
|---|---|
| PubChem CID | 58603110 |
| Molecular Formula | C10H12N8O4 |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 2-amino-8-[5-(azidomethyl)-3,4-dihydroxyoxolan-2-yl]imidazo[1,2-a][1,3,5]triazin-4-one |
| SMILES | [N-]=[N+]=NCC1OC(n2ccn3c(=O)nc(N)nc23)C(O)C1O |
| InChI | InChI=1S/C10H12N8O4/c11-8-14-9-17(1-2-18(9)10(21)15-8)7-6(20)5(19)4(22-7)3-13-16-12/h1-2,4-7,19-20H,3H2,(H2,11,15,21) |
| InChIKey | GEHOVERGPJZSEC-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 176.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|